C20H25N3O4 — CID 164695950
methyl 2-[[(1R,8S,9S)-6-oxo-8-propyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 164695950) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is methyl 2-[[(1R,8S,9S)-6-oxo-8-propyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[(1R,8S,9S)-6-oxo-8-propyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 164695950 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | methyl 2-[[(1R,8S,9S)-6-oxo-8-propyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCC[C@H]1[C@H]2C[C@H](CN(Cc3nc(C(=O)OC)co3)C2)c2cccc(=O)n21 |
| InChI | InChI=1S/C20H25N3O4/c1-3-5-16-13-8-14(17-6-4-7-19(24)23(16)17)10-22(9-13)11-18-21-15(12-27-18)20(25)26-2/h4,6-7,12-14,16H,3,5,8-11H2,1-2H3/t13-,14+,16-/m0/s1 |
| InChIKey | PEPAVLYNKNJGCR-LZWOXQAQSA-N |
| XLogP | 2.58 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |