C22H22N4O4 — CID 175643867
methyl 2-[[(1R,9S)-6-oxo-4-pyridin-2-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 175643867) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is methyl 2-[[(1R,9S)-6-oxo-4-pyridin-2-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[(1R,9S)-6-oxo-4-pyridin-2-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 175643867 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | methyl 2-[[(1R,9S)-6-oxo-4-pyridin-2-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(CN2C[C@@H]3C[C@H](C2)c2cc(-c4ccccn4)cc(=O)n2C3)n1 |
| InChI | InChI=1S/C22H22N4O4/c1-29-22(28)18-13-30-20(24-18)12-25-9-14-6-16(11-25)19-7-15(8-21(27)26(19)10-14)17-4-2-3-5-23-17/h2-5,7-8,13-14,16H,6,9-12H2,1H3/t14-,16+/m0/s1 |
| InChIKey | PDHSHJHTGVUWHZ-GOEBONIOSA-N |
| XLogP | 2.30 |
| TPSA | 90.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |