C21H25ClN2O3 — CID 176503241
(3aR,5R,6R,7aS)-2-[(5-chloro-2-pyridinyl)methyl]-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 176503241) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(5-chloro-2-pyridinyl)methyl]-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[(5-chloro-2-pyridinyl)methyl]-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 176503241 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(5-chloro-2-pyridinyl)methyl]-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | COc1ccccc1O[C@@H]1C[C@@H]2CN(Cc3ccc(Cl)cn3)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C21H25ClN2O3/c1-26-19-4-2-3-5-20(19)27-21-9-15-12-24(11-14(15)8-18(21)25)13-17-7-6-16(22)10-23-17/h2-7,10,14-15,18,21,25H,8-9,11-13H2,1H3/t14-,15+,18+,21+/m0/s1 |
| InChIKey | YVWBQMVAYTZSEO-JTQINKHRSA-N |
| XLogP | 3.39 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |