C21H25N3O5 — CID 172670668
methyl 5-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]pyrazine-2-carboxylate (PubChem CID 172670668) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is methyl 5-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]pyrazine-2-carboxylate.
| Compound Name | methyl 5-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 172670668 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | methyl 5-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(N2C[C@H]3C[C@@H](Oc4ccccc4OC)[C@H](O)C[C@H]3C2)cn1 |
| InChI | InChI=1S/C21H25N3O5/c1-27-17-5-3-4-6-18(17)29-19-8-14-12-24(11-13(14)7-16(19)25)20-10-22-15(9-23-20)21(26)28-2/h3-6,9-10,13-14,16,19,25H,7-8,11-12H2,1-2H3/t13-,14+,16+,19+/m0/s1 |
| InChIKey | KRANLRWKBJEVOH-XWESNNAXSA-N |
| XLogP | 1.93 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |