C22H27N3O4 — CID 172666411
2-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-6-methylpyridine-3-carboxamide (PubChem CID 172666411) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-6-methylpyridine-3-carboxamide.
| Compound Name | 2-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 172666411 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-6-methylpyridine-3-carboxamide |
| SMILES | COc1ccccc1O[C@@H]1C[C@@H]2CN(c3nc(C)ccc3C(N)=O)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C22H27N3O4/c1-13-7-8-16(21(23)27)22(24-13)25-11-14-9-17(26)20(10-15(14)12-25)29-19-6-4-3-5-18(19)28-2/h3-8,14-15,17,20,26H,9-12H2,1-2H3,(H2,23,27)/t14-,15+,17+,20+/m0/s1 |
| InChIKey | LUEBNWNMGKHKAH-DKYLXPRQSA-N |
| XLogP | 2.15 |
| TPSA | 97.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |