C25H29N3O3 — CID 172655749
2-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 172655749) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 172655749 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | COc1ccccc1O[C@@H]1C[C@@H]2CN(c3nc4c(cc3C#N)CCCC4)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C25H29N3O3/c1-30-22-8-4-5-9-23(22)31-24-12-19-15-28(14-18(19)11-21(24)29)25-17(13-26)10-16-6-2-3-7-20(16)27-25/h4-5,8-10,18-19,21,24,29H,2-3,6-7,11-12,14-15H2,1H3/t18-,19+,21+,24+/m0/s1 |
| InChIKey | QUDAFJGMAYVSIZ-YWQGAKJTSA-N |
| XLogP | 3.50 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |