C25H33ClN2O5 — CID 172913231
[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(2-aminoethoxy)-5-methylphenyl]methanone;hydrochloride (PubChem CID 172913231) has the molecular formula C25H33ClN2O5 and a molecular weight of 477.00 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(2-aminoethoxy)-5-methylphenyl]methanone;hydrochloride.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(2-aminoethoxy)-5-methylphenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 172913231 |
| Molecular Formula | C25H33ClN2O5 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(2-aminoethoxy)-5-methylphenyl]methanone;hydrochloride |
| SMILES | COc1ccccc1O[C@@H]1C[C@@H]2CN(C(=O)c3cc(C)ccc3OCCN)C[C@@H]2C[C@H]1O.Cl |
| InChI | InChI=1S/C25H32N2O5.ClH/c1-16-7-8-21(31-10-9-26)19(11-16)25(29)27-14-17-12-20(28)24(13-18(17)15-27)32-23-6-4-3-5-22(23)30-2;/h3-8,11,17-18,20,24,28H,9-10,12-15,26H2,1-2H3;1H/t17-,18+,20+,24+;/m0./s1 |
| InChIKey | PLNNPNWYMNSUMG-ZAYVGNNISA-N |
| XLogP | 3.05 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |