C23H24N2O5 — CID 172657396
[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,3-benzoxazol-2-yl)methanone (PubChem CID 172657396) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,3-benzoxazol-2-yl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,3-benzoxazol-2-yl)methanone |
|---|---|
| PubChem CID | 172657396 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,3-benzoxazol-2-yl)methanone |
| SMILES | COc1ccccc1O[C@@H]1C[C@@H]2CN(C(=O)c3nc4ccccc4o3)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C23H24N2O5/c1-28-19-8-4-5-9-20(19)29-21-11-15-13-25(12-14(15)10-17(21)26)23(27)22-24-16-6-2-3-7-18(16)30-22/h2-9,14-15,17,21,26H,10-13H2,1H3/t14-,15+,17+,21+/m0/s1 |
| InChIKey | AZJPBIUUTHMFAE-GYQJYAJYSA-N |
| XLogP | 3.13 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |