C22H24N4O4 — CID 172658719
[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-([1,2,4]triazolo[4,3-a]pyridin-8-yl)methanone (PubChem CID 172658719) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-([1,2,4]triazolo[4,3-a]pyridin-8-yl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-([1,2,4]triazolo[4,3-a]pyridin-8-yl)methanone |
|---|---|
| PubChem CID | 172658719 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-([1,2,4]triazolo[4,3-a]pyridin-8-yl)methanone |
| SMILES | COc1ccccc1O[C@@H]1C[C@@H]2CN(C(=O)c3cccn4cnnc34)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C22H24N4O4/c1-29-18-6-2-3-7-19(18)30-20-10-15-12-26(11-14(15)9-17(20)27)22(28)16-5-4-8-25-13-23-24-21(16)25/h2-8,13-15,17,20,27H,9-12H2,1H3/t14-,15+,17+,20+/m0/s1 |
| InChIKey | TWHUHCDQRQEWGQ-DKYLXPRQSA-N |
| XLogP | 2.03 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |