C23H28N2O6 — CID 176500300
[(3aS,5R,6R,7aR)-5-(2,3-dimethoxyphenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-methoxy-4-pyridinyl)methanone (PubChem CID 176500300) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(2,3-dimethoxyphenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-methoxy-4-pyridinyl)methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-(2,3-dimethoxyphenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-methoxy-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 176500300 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(2,3-dimethoxyphenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-methoxy-4-pyridinyl)methanone |
| SMILES | COc1cnccc1C(=O)N1C[C@H]2C[C@@H](Oc3cccc(OC)c3OC)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C23H28N2O6/c1-28-18-5-4-6-19(22(18)30-3)31-20-10-15-13-25(12-14(15)9-17(20)26)23(27)16-7-8-24-11-21(16)29-2/h4-8,11,14-15,17,20,26H,9-10,12-13H2,1-3H3/t14-,15+,17+,20+/m0/s1 |
| InChIKey | LUAYNYFEXWAQMG-DKYLXPRQSA-N |
| XLogP | 2.40 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |