C26H30N2O4 — CID 172673171
[(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,7-dimethylindol-2-yl)methanone (PubChem CID 172673171) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,7-dimethylindol-2-yl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,7-dimethylindol-2-yl)methanone |
|---|---|
| PubChem CID | 172673171 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-hydroxy-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,7-dimethylindol-2-yl)methanone |
| SMILES | COc1ccccc1O[C@@H]1C[C@@H]2CN(C(=O)c3cc4cccc(C)c4n3C)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C26H30N2O4/c1-16-7-6-8-17-11-20(27(2)25(16)17)26(30)28-14-18-12-21(29)24(13-19(18)15-28)32-23-10-5-4-9-22(23)31-3/h4-11,18-19,21,24,29H,12-15H2,1-3H3/t18-,19+,21+,24+/m0/s1 |
| InChIKey | TUWHROSPDFNEMZ-YWQGAKJTSA-N |
| XLogP | 3.79 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |