C16H18F2N2O — CID 72848626
(4,4-difluoropiperidin-1-yl)-(1,7-dimethylindol-2-yl)methanone (PubChem CID 72848626) has the molecular formula C16H18F2N2O and a molecular weight of 292.33 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-(1,7-dimethylindol-2-yl)methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-(1,7-dimethylindol-2-yl)methanone |
|---|---|
| PubChem CID | 72848626 |
| Molecular Formula | C16H18F2N2O |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-(1,7-dimethylindol-2-yl)methanone |
| SMILES | Cc1cccc2cc(C(=O)N3CCC(F)(F)CC3)n(C)c12 |
| InChI | InChI=1S/C16H18F2N2O/c1-11-4-3-5-12-10-13(19(2)14(11)12)15(21)20-8-6-16(17,18)7-9-20/h3-5,10H,6-9H2,1-2H3 |
| InChIKey | GHOQREWAOVGOFT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |