C13H14N2O3 — CID 110835889
2-[(1,7-dimethylindole-2-carbonyl)amino]acetic acid (PubChem CID 110835889) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-[(1,7-dimethylindole-2-carbonyl)amino]acetic acid.
| Compound Name | 2-[(1,7-dimethylindole-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 110835889 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-[(1,7-dimethylindole-2-carbonyl)amino]acetic acid |
| SMILES | Cc1cccc2cc(C(=O)NCC(=O)O)n(C)c12 |
| InChI | InChI=1S/C13H14N2O3/c1-8-4-3-5-9-6-10(15(2)12(8)9)13(18)14-7-11(16)17/h3-6H,7H2,1-2H3,(H,14,18)(H,16,17) |
| InChIKey | SORLURHVQWUCFQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |