C15H18N2O3S — CID 110852739
N-(1,1-dioxothiolan-3-yl)-1,7-dimethylindole-2-carboxamide (PubChem CID 110852739) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1,7-dimethylindole-2-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1,7-dimethylindole-2-carboxamide |
|---|---|
| PubChem CID | 110852739 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1,7-dimethylindole-2-carboxamide |
| SMILES | Cc1cccc2cc(C(=O)NC3CCS(=O)(=O)C3)n(C)c12 |
| InChI | InChI=1S/C15H18N2O3S/c1-10-4-3-5-11-8-13(17(2)14(10)11)15(18)16-12-6-7-21(19,20)9-12/h3-5,8,12H,6-7,9H2,1-2H3,(H,16,18) |
| InChIKey | YBIBGDPVLSNXSZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |