C13H13N3O3S — CID 110705072
N-(1,1-dioxothiolan-3-yl)cinnoline-3-carboxamide (PubChem CID 110705072) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)cinnoline-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)cinnoline-3-carboxamide |
|---|---|
| PubChem CID | 110705072 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)cinnoline-3-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cc2ccccc2nn1 |
| InChI | InChI=1S/C13H13N3O3S/c17-13(14-10-5-6-20(18,19)8-10)12-7-9-3-1-2-4-11(9)15-16-12/h1-4,7,10H,5-6,8H2,(H,14,17) |
| InChIKey | ZZEPJSSEOXJXFN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |