C12H13N3O3S — CID 46287275
N-(1,1-dioxothiolan-3-yl)pyrazolo[1,5-a]pyridine-2-carboxamide (PubChem CID 46287275) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)pyrazolo[1,5-a]pyridine-2-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)pyrazolo[1,5-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 46287275 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)pyrazolo[1,5-a]pyridine-2-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cc2ccccn2n1 |
| InChI | InChI=1S/C12H13N3O3S/c16-12(13-9-4-6-19(17,18)8-9)11-7-10-3-1-2-5-15(10)14-11/h1-3,5,7,9H,4,6,8H2,(H,13,16) |
| InChIKey | YFJOQKZROLRUNU-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |