C15H18N2O — CID 7329070
(1,5-dimethylindol-2-yl)-pyrrolidin-1-ylmethanone (PubChem CID 7329070) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is (1,5-dimethylindol-2-yl)-pyrrolidin-1-ylmethanone.
| Compound Name | (1,5-dimethylindol-2-yl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 7329070 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | (1,5-dimethylindol-2-yl)-pyrrolidin-1-ylmethanone |
| SMILES | Cc1ccc2c(c1)cc(C(=O)N1CCCC1)n2C |
| InChI | InChI=1S/C15H18N2O/c1-11-5-6-13-12(9-11)10-14(16(13)2)15(18)17-7-3-4-8-17/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | UQENOTNAMYIZQV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |