C24H28N2O2 — CID 124582318
(1,5-dimethylindol-2-yl)-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]methanone (PubChem CID 124582318) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (1,5-dimethylindol-2-yl)-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]methanone.
| Compound Name | (1,5-dimethylindol-2-yl)-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 124582318 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (1,5-dimethylindol-2-yl)-[(2R)-2-(4-methoxyphenyl)azepan-1-yl]methanone |
| SMILES | COc1ccc([C@H]2CCCCCN2C(=O)c2cc3cc(C)ccc3n2C)cc1 |
| InChI | InChI=1S/C24H28N2O2/c1-17-8-13-21-19(15-17)16-23(25(21)2)24(27)26-14-6-4-5-7-22(26)18-9-11-20(28-3)12-10-18/h8-13,15-16,22H,4-7,14H2,1-3H3/t22-/m1/s1 |
| InChIKey | SJINAZBEVNSAJX-JOCHJYFZSA-N |
| XLogP | 5.25 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |