About [5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone
[5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone (PubChem CID 143170987) has the molecular formula C22H31N3O2S
and a molecular weight of 401.58 g/mol. Its IUPAC name is [5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | [5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone |
| PubChem CID | 143170987 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | [5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone |
| SMILES | CC1CC(C)CN(S(=O)c2ccc3c(c2)cc(C(=O)N2CCCCC2)n3C)C1 |
| InChI | InChI=1S/C22H31N3O2S/c1-16-11-17(2)15-25(14-16)28(27)19-7-8-20-18(12-19)13-21(23(20)3)22(26)24-9-5-4-6-10-24/h7-8,12-13,16-17H,4-6,9-11,14-15H2,1-3H3 |
| InChIKey | JCGJOROEMUHGJD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone?
The IUPAC name of [5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone (CID 143170987) is [5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone.
What is the SMILES notation for [5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone?
The canonical SMILES for [5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone is CC1CC(C)CN(S(=O)c2ccc3c(c2)cc(C(=O)N2CCCCC2)n3C)C1.
What is the InChIKey of [5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone?
The InChIKey is JCGJOROEMUHGJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N3O2S/c1-16-11-17(2)15-25(14-16)28(27)19-7-8-20-18(12-19)13-21(23(20)3)22(26)24-9-5-4-6-10-24/h7-8,12-13,16-17H,4-6,9-11,14-15H2,1-3H3.
What are the key properties of [5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone?
[5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone has a molecular weight of 401.58 g/mol, XLogP of 3.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,5-dimethylpiperidin-1-yl)sulfinyl-1-methylindol-2-yl]-piperidin-1-ylmethanone is sourced from PubChem (CID 143170987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).