C15H15FN2O2 — CID 97181355
(5-fluoro-1-methylindol-2-yl)-[(1S,6R)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]methanone (PubChem CID 97181355) has the molecular formula C15H15FN2O2 and a molecular weight of 274.29 g/mol. Its IUPAC name is (5-fluoro-1-methylindol-2-yl)-[(1S,6R)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]methanone.
| Compound Name | (5-fluoro-1-methylindol-2-yl)-[(1S,6R)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]methanone |
|---|---|
| PubChem CID | 97181355 |
| Molecular Formula | C15H15FN2O2 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (5-fluoro-1-methylindol-2-yl)-[(1S,6R)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]methanone |
| SMILES | Cn1c(C(=O)N2CC[C@H]3O[C@H]3C2)cc2cc(F)ccc21 |
| InChI | InChI=1S/C15H15FN2O2/c1-17-11-3-2-10(16)6-9(11)7-12(17)15(19)18-5-4-13-14(8-18)20-13/h2-3,6-7,13-14H,4-5,8H2,1H3/t13-,14+/m1/s1 |
| InChIKey | OOKDZFQLODGDJD-KGLIPLIRSA-N |
| XLogP | 1.93 |
| TPSA | 37.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|