C18H21FN4O3 — CID 110086615
1-acetyl-4-(5-fluoro-1-methylindole-2-carbonyl)-N-methylpiperazine-2-carboxamide (PubChem CID 110086615) has the molecular formula C18H21FN4O3 and a molecular weight of 360.39 g/mol. Its IUPAC name is 1-acetyl-4-(5-fluoro-1-methylindole-2-carbonyl)-N-methylpiperazine-2-carboxamide.
| Compound Name | 1-acetyl-4-(5-fluoro-1-methylindole-2-carbonyl)-N-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 110086615 |
| Molecular Formula | C18H21FN4O3 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-acetyl-4-(5-fluoro-1-methylindole-2-carbonyl)-N-methylpiperazine-2-carboxamide |
| SMILES | CNC(=O)C1CN(C(=O)c2cc3cc(F)ccc3n2C)CCN1C(C)=O |
| InChI | InChI=1S/C18H21FN4O3/c1-11(24)23-7-6-22(10-16(23)17(25)20-2)18(26)15-9-12-8-13(19)4-5-14(12)21(15)3/h4-5,8-9,16H,6-7,10H2,1-3H3,(H,20,25) |
| InChIKey | MUURHACGAIKFKW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |