C21H29N3O3S2 — CID 70792505
[5-(3,5-dimethylpiperidin-1-yl)sulfonyl-1-sulfanylindol-2-yl]-piperidin-1-ylmethanone (PubChem CID 70792505) has the molecular formula C21H29N3O3S2 and a molecular weight of 435.62 g/mol. Its IUPAC name is [5-(3,5-dimethylpiperidin-1-yl)sulfonyl-1-sulfanylindol-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [5-(3,5-dimethylpiperidin-1-yl)sulfonyl-1-sulfanylindol-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 70792505 |
| Molecular Formula | C21H29N3O3S2 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [5-(3,5-dimethylpiperidin-1-yl)sulfonyl-1-sulfanylindol-2-yl]-piperidin-1-ylmethanone |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc3c(c2)cc(C(=O)N2CCCCC2)n3S)C1 |
| InChI | InChI=1S/C21H29N3O3S2/c1-15-10-16(2)14-23(13-15)29(26,27)18-6-7-19-17(11-18)12-20(24(19)28)21(25)22-8-4-3-5-9-22/h6-7,11-12,15-16,28H,3-5,8-10,13-14H2,1-2H3 |
| InChIKey | SARBLRMLXVXEDB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|