C21H29N3O3S — CID 11718353
[5-(azepan-1-ylsulfonyl)-1H-indol-2-yl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 11718353) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is [5-(azepan-1-ylsulfonyl)-1H-indol-2-yl]-(3-methylpiperidin-1-yl)methanone.
| Compound Name | [5-(azepan-1-ylsulfonyl)-1H-indol-2-yl]-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 11718353 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | [5-(azepan-1-ylsulfonyl)-1H-indol-2-yl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)c2cc3cc(S(=O)(=O)N4CCCCCC4)ccc3[nH]2)C1 |
| InChI | InChI=1S/C21H29N3O3S/c1-16-7-6-10-23(15-16)21(25)20-14-17-13-18(8-9-19(17)22-20)28(26,27)24-11-4-2-3-5-12-24/h8-9,13-14,16,22H,2-7,10-12,15H2,1H3 |
| InChIKey | BETKVVOGMZBRPG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |