C19H27N3O4S — CID 18280417
1-[4-[3-(3-methylpiperidine-1-carbonyl)phenyl]sulfonylpiperazin-1-yl]ethanone (PubChem CID 18280417) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is 1-[4-[3-(3-methylpiperidine-1-carbonyl)phenyl]sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 1-[4-[3-(3-methylpiperidine-1-carbonyl)phenyl]sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 18280417 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-[4-[3-(3-methylpiperidine-1-carbonyl)phenyl]sulfonylpiperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2cccc(C(=O)N3CCCC(C)C3)c2)CC1 |
| InChI | InChI=1S/C19H27N3O4S/c1-15-5-4-8-21(14-15)19(24)17-6-3-7-18(13-17)27(25,26)22-11-9-20(10-12-22)16(2)23/h3,6-7,13,15H,4-5,8-12,14H2,1-2H3 |
| InChIKey | HJAKEJVHMMPIAL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |