C17H24N2O4S — CID 8764281
[(3S)-3-methylpiperidin-1-yl]-(3-morpholin-4-ylsulfonylphenyl)methanone (PubChem CID 8764281) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is [(3S)-3-methylpiperidin-1-yl]-(3-morpholin-4-ylsulfonylphenyl)methanone.
| Compound Name | [(3S)-3-methylpiperidin-1-yl]-(3-morpholin-4-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 8764281 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [(3S)-3-methylpiperidin-1-yl]-(3-morpholin-4-ylsulfonylphenyl)methanone |
| SMILES | C[C@H]1CCCN(C(=O)c2cccc(S(=O)(=O)N3CCOCC3)c2)C1 |
| InChI | InChI=1S/C17H24N2O4S/c1-14-4-3-7-18(13-14)17(20)15-5-2-6-16(12-15)24(21,22)19-8-10-23-11-9-19/h2,5-6,12,14H,3-4,7-11,13H2,1H3/t14-/m0/s1 |
| InChIKey | ZYWHKHYNHPFCBW-AWEZNQCLSA-N |
| XLogP | 1.58 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |