C19H27N3O4S — CID 9061003
N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 9061003) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 9061003 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[[(2R,6R)-2,6-dimethylcyclohexylidene]amino]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | C[C@@H]1CCC[C@@H](C)C1=NNC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H27N3O4S/c1-14-5-3-6-15(2)18(14)20-21-19(23)16-7-4-8-17(13-16)27(24,25)22-9-11-26-12-10-22/h4,7-8,13-15H,3,5-6,9-12H2,1-2H3,(H,21,23)/t14-,15-/m1/s1 |
| InChIKey | RQZIZLXRIIBTFM-HUUCEWRRSA-N |
| XLogP | 2.25 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|