C21H31N3O4S — CID 9061050
N-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 9061050) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is N-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 9061050 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CC(C)[C@@H]1CC[C@H](C)C/C1=N/NC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H31N3O4S/c1-15(2)19-8-7-16(3)13-20(19)22-23-21(25)17-5-4-6-18(14-17)29(26,27)24-9-11-28-12-10-24/h4-6,14-16,19H,7-13H2,1-3H3,(H,23,25)/b22-20-/t16-,19-/m0/s1 |
| InChIKey | LOISPEQCKFGCHX-PSHREBAWSA-N |
| XLogP | 2.89 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|