C21H31N3O4S — CID 9061053
N-[(Z)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 9061053) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is N-[(Z)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[(Z)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 9061053 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[(Z)-[(3R)-3,7-dimethyloct-6-enylidene]amino]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CC(C)=CCC[C@@H](C)C/C=N\NC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H31N3O4S/c1-17(2)6-4-7-18(3)10-11-22-23-21(25)19-8-5-9-20(16-19)29(26,27)24-12-14-28-15-13-24/h5-6,8-9,11,16,18H,4,7,10,12-15H2,1-3H3,(H,23,25)/b22-11-/t18-/m1/s1 |
| InChIKey | UDDWXQQJVUPBRL-DSDJNCIMSA-N |
| XLogP | 3.20 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|