C17H23ClN2O — CID 9174950
3-chloro-N-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]benzamide (PubChem CID 9174950) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]benzamide.
| Compound Name | 3-chloro-N-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]benzamide |
|---|---|
| PubChem CID | 9174950 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 3-chloro-N-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]benzamide |
| SMILES | CC(C)[C@@H]1CC[C@H](C)C/C1=N/NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H23ClN2O/c1-11(2)15-8-7-12(3)9-16(15)19-20-17(21)13-5-4-6-14(18)10-13/h4-6,10-12,15H,7-9H2,1-3H3,(H,20,21)/b19-16-/t12-,15-/m0/s1 |
| InChIKey | ZPXPTDGMARKWMW-ZXCHJEISSA-N |
| XLogP | 4.52 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|