C20H18Cl2N4O2 — CID 1240483
3-chloro-N-[[4-[(3-chlorobenzoyl)hydrazinylidene]cyclohexylidene]amino]benzamide (PubChem CID 1240483) has the molecular formula C20H18Cl2N4O2 and a molecular weight of 417.30 g/mol. Its IUPAC name is 3-chloro-N-[[4-[(3-chlorobenzoyl)hydrazinylidene]cyclohexylidene]amino]benzamide.
| Compound Name | 3-chloro-N-[[4-[(3-chlorobenzoyl)hydrazinylidene]cyclohexylidene]amino]benzamide |
|---|---|
| PubChem CID | 1240483 |
| Molecular Formula | C20H18Cl2N4O2 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 3-chloro-N-[[4-[(3-chlorobenzoyl)hydrazinylidene]cyclohexylidene]amino]benzamide |
| SMILES | O=C(NN=C1CCC(=NNC(=O)c2cccc(Cl)c2)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H18Cl2N4O2/c21-15-5-1-3-13(11-15)19(27)25-23-17-7-9-18(10-8-17)24-26-20(28)14-4-2-6-16(22)12-14/h1-6,11-12H,7-10H2,(H,25,27)(H,26,28)/b23-17-,24-18+ |
| InChIKey | YQCHRIVORYMDPF-QFFDILLMSA-N |
| XLogP | 4.44 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|