C10H9Cl3N2O — CID 46741785
3-chloro-N-(1,3-dichloropropan-2-ylideneamino)benzamide (PubChem CID 46741785) has the molecular formula C10H9Cl3N2O and a molecular weight of 279.55 g/mol. Its IUPAC name is 3-chloro-N-(1,3-dichloropropan-2-ylideneamino)benzamide.
| Compound Name | 3-chloro-N-(1,3-dichloropropan-2-ylideneamino)benzamide |
|---|---|
| PubChem CID | 46741785 |
| Molecular Formula | C10H9Cl3N2O |
| Molecular Weight | 279.55 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 3-chloro-N-(1,3-dichloropropan-2-ylideneamino)benzamide |
| SMILES | O=C(NN=C(CCl)CCl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H9Cl3N2O/c11-5-9(6-12)14-15-10(16)7-2-1-3-8(13)4-7/h1-4H,5-6H2,(H,15,16) |
| InChIKey | JNJOYKXYQZNTQD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|