C24H19ClN2O — CID 92859984
3-chloro-N-[[(1Z,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino]benzamide (PubChem CID 92859984) has the molecular formula C24H19ClN2O and a molecular weight of 386.88 g/mol. Its IUPAC name is 3-chloro-N-[[(1Z,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino]benzamide.
| Compound Name | 3-chloro-N-[[(1Z,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 92859984 |
| Molecular Formula | C24H19ClN2O |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 3-chloro-N-[[(1Z,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino]benzamide |
| SMILES | O=C(N/N=C(/C=C\c1ccccc1)\C=C\c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H19ClN2O/c25-22-13-7-12-21(18-22)24(28)27-26-23(16-14-19-8-3-1-4-9-19)17-15-20-10-5-2-6-11-20/h1-18H,(H,27,28)/b16-14-,17-15+,26-23- |
| InChIKey | ULFFJSMVVAOPDR-WVWRDYBMSA-N |
| XLogP | 5.85 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|