C14H15ClN2O — CID 40554029
N-[(Z)-[(1S,4R)-2-bicyclo[2.2.1]heptanylidene]amino]-3-chlorobenzamide (PubChem CID 40554029) has the molecular formula C14H15ClN2O and a molecular weight of 262.74 g/mol. Its IUPAC name is N-[(Z)-[(1S,4R)-2-bicyclo[2.2.1]heptanylidene]amino]-3-chlorobenzamide.
| Compound Name | N-[(Z)-[(1S,4R)-2-bicyclo[2.2.1]heptanylidene]amino]-3-chlorobenzamide |
|---|---|
| PubChem CID | 40554029 |
| Molecular Formula | C14H15ClN2O |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | N-[(Z)-[(1S,4R)-2-bicyclo[2.2.1]heptanylidene]amino]-3-chlorobenzamide |
| SMILES | O=C(N/N=C1/C[C@@H]2CC[C@H]1C2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H15ClN2O/c15-12-3-1-2-11(8-12)14(18)17-16-13-7-9-4-5-10(13)6-9/h1-3,8-10H,4-7H2,(H,17,18)/b16-13-/t9-,10+/m1/s1 |
| InChIKey | OJENRIOVNQIVOW-UUAQCMHYSA-N |
| XLogP | 3.25 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|