C17H22N2O4 — CID 7308879
N-[(E)-[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]-3,4,5-trimethoxybenzamide (PubChem CID 7308879) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is N-[(E)-[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(E)-[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 7308879 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-[(E)-[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C2\C[C@H]3CC[C@H]2C3)cc(OC)c1OC |
| InChI | InChI=1S/C17H22N2O4/c1-21-14-8-12(9-15(22-2)16(14)23-3)17(20)19-18-13-7-10-4-5-11(13)6-10/h8-11H,4-7H2,1-3H3,(H,19,20)/b18-13+/t10-,11-/m0/s1 |
| InChIKey | VDAJYEQZNCDILE-CCGRPZKVSA-N |
| XLogP | 2.62 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|