C19H26N2O4 — CID 7256309
N-[(Z)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 7256309) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[(Z)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(Z)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 7256309 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-[(Z)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C(/C)[C@@H]2C[C@H]3CC[C@H]2C3)cc(OC)c1OC |
| InChI | InChI=1S/C19H26N2O4/c1-11(15-8-12-5-6-13(15)7-12)20-21-19(22)14-9-16(23-2)18(25-4)17(10-14)24-3/h9-10,12-13,15H,5-8H2,1-4H3,(H,21,22)/b20-11-/t12-,13-,15-/m0/s1 |
| InChIKey | AVTPWNSWYYPBDO-DUTFFDMHSA-N |
| XLogP | 3.25 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|