C16H20N2O2 — CID 98659475
N-[(Z)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2-hydroxybenzamide (PubChem CID 98659475) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[(Z)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2-hydroxybenzamide.
| Compound Name | N-[(Z)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 98659475 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[(Z)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2-hydroxybenzamide |
| SMILES | C/C(=N/NC(=O)c1ccccc1O)[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C16H20N2O2/c1-10(14-9-11-6-7-12(14)8-11)17-18-16(20)13-4-2-3-5-15(13)19/h2-5,11-12,14,19H,6-9H2,1H3,(H,18,20)/b17-10-/t11-,12-,14+/m0/s1 |
| InChIKey | FENJDODVLIIMQQ-UUMQHJJASA-N |
| XLogP | 2.93 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|