C16H19BrN2O — CID 11895622
N-[(Z)-1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-3-bromobenzamide (PubChem CID 11895622) has the molecular formula C16H19BrN2O and a molecular weight of 335.25 g/mol. Its IUPAC name is N-[(Z)-1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-3-bromobenzamide.
| Compound Name | N-[(Z)-1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-3-bromobenzamide |
|---|---|
| PubChem CID | 11895622 |
| Molecular Formula | C16H19BrN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-[(Z)-1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-3-bromobenzamide |
| SMILES | C/C(=N/NC(=O)c1cccc(Br)c1)[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C16H19BrN2O/c1-10(15-8-11-5-6-12(15)7-11)18-19-16(20)13-3-2-4-14(17)9-13/h2-4,9,11-12,15H,5-8H2,1H3,(H,19,20)/b18-10-/t11-,12+,15-/m0/s1 |
| InChIKey | CXZXCGNXJUJTER-MHPASMAOSA-N |
| XLogP | 3.99 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|