C22H34N4O2 — CID 3254874
N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethylideneamino]butanediamide (PubChem CID 3254874) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethylideneamino]butanediamide.
| Compound Name | N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethylideneamino]butanediamide |
|---|---|
| PubChem CID | 3254874 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethylideneamino]butanediamide |
| SMILES | CC(=NNC(=O)CCC(=O)NN=C(C)C1CC2CCC1C2)C1CC2CCC1C2 |
| InChI | InChI=1S/C22H34N4O2/c1-13(19-11-15-3-5-17(19)9-15)23-25-21(27)7-8-22(28)26-24-14(2)20-12-16-4-6-18(20)10-16/h15-20H,3-12H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | ROLLTMVEPZVOJN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|