C17H21ClN2O2 — CID 3454323
N-[1-(2-bicyclo[2.2.1]heptanyl)ethylideneamino]-2-(4-chlorophenoxy)acetamide (PubChem CID 3454323) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethylideneamino]-2-(4-chlorophenoxy)acetamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethylideneamino]-2-(4-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 3454323 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethylideneamino]-2-(4-chlorophenoxy)acetamide |
| SMILES | CC(=NNC(=O)COc1ccc(Cl)cc1)C1CC2CCC1C2 |
| InChI | InChI=1S/C17H21ClN2O2/c1-11(16-9-12-2-3-13(16)8-12)19-20-17(21)10-22-15-6-4-14(18)5-7-15/h4-7,12-13,16H,2-3,8-10H2,1H3,(H,20,21) |
| InChIKey | KKYQXKAUHHWTPS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|