C19H24Cl2N2O2 — CID 98293049
N-[(Z)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 98293049) has the molecular formula C19H24Cl2N2O2 and a molecular weight of 383.32 g/mol. Its IUPAC name is N-[(Z)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-[(Z)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 98293049 |
| Molecular Formula | C19H24Cl2N2O2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-[(Z)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | C/C(=N/NC(=O)CCCOc1ccc(Cl)cc1Cl)[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C19H24Cl2N2O2/c1-12(16-10-13-4-5-14(16)9-13)22-23-19(24)3-2-8-25-18-7-6-15(20)11-17(18)21/h6-7,11,13-14,16H,2-5,8-10H2,1H3,(H,23,24)/b22-12-/t13-,14-,16+/m1/s1 |
| InChIKey | OABVOERAKHNDFR-YXYSCGMMSA-N |
| XLogP | 5.08 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|