C17H20Cl2N2O2 — CID 4135723
N-(2-bicyclo[2.2.1]heptanylideneamino)-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 4135723) has the molecular formula C17H20Cl2N2O2 and a molecular weight of 355.27 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylideneamino)-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylideneamino)-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 4135723 |
| Molecular Formula | C17H20Cl2N2O2 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylideneamino)-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NN=C1CC2CCC1C2 |
| InChI | InChI=1S/C17H20Cl2N2O2/c18-13-5-6-16(14(19)10-13)23-7-1-2-17(22)21-20-15-9-11-3-4-12(15)8-11/h5-6,10-12H,1-4,7-9H2,(H,21,22) |
| InChIKey | DZZDJTNKTPEIPV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|