C18H21ClN2O2 — CID 51421239
N-[(E)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-4-(4-chloro-2-methylphenoxy)butanamide (PubChem CID 51421239) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is N-[(E)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-4-(4-chloro-2-methylphenoxy)butanamide.
| Compound Name | N-[(E)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-4-(4-chloro-2-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 51421239 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[(E)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-4-(4-chloro-2-methylphenoxy)butanamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)N/N=C1\C[C@@H]2C=CC[C@@H]12 |
| InChI | InChI=1S/C18H21ClN2O2/c1-12-10-14(19)7-8-17(12)23-9-3-6-18(22)21-20-16-11-13-4-2-5-15(13)16/h2,4,7-8,10,13,15H,3,5-6,9,11H2,1H3,(H,21,22)/b20-16+/t13-,15+/m0/s1 |
| InChIKey | MBBDAZBEWAXJNN-UPQQWNPYSA-N |
| XLogP | 3.88 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|