C16H18Cl2N2O — CID 129439872
N-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2,4-dichlorobenzamide (PubChem CID 129439872) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is N-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2,4-dichlorobenzamide.
| Compound Name | N-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 129439872 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-[1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2,4-dichlorobenzamide |
| SMILES | CC(=NNC(=O)c1ccc(Cl)cc1Cl)[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C16H18Cl2N2O/c1-9(14-7-10-2-3-11(14)6-10)19-20-16(21)13-5-4-12(17)8-15(13)18/h4-5,8,10-11,14H,2-3,6-7H2,1H3,(H,20,21)/t10-,11-,14+/m0/s1 |
| InChIKey | PCGSMNRXCOXARN-COPLHBTASA-N |
| XLogP | 4.54 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|