C19H25ClN2O2 — CID 98906702
(2R)-N-[(E)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2-(4-chloro-2-methylphenoxy)propanamide (PubChem CID 98906702) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is (2R)-N-[(E)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2-(4-chloro-2-methylphenoxy)propanamide.
| Compound Name | (2R)-N-[(E)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2-(4-chloro-2-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 98906702 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (2R)-N-[(E)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2-(4-chloro-2-methylphenoxy)propanamide |
| SMILES | C/C(=N\NC(=O)[C@@H](C)Oc1ccc(Cl)cc1C)[C@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C19H25ClN2O2/c1-11-8-16(20)6-7-18(11)24-13(3)19(23)22-21-12(2)17-10-14-4-5-15(17)9-14/h6-8,13-15,17H,4-5,9-10H2,1-3H3,(H,22,23)/b21-12+/t13-,14-,15-,17-/m1/s1 |
| InChIKey | DRNISQFRIZSJKT-SDGBZKFCSA-N |
| XLogP | 4.34 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|