C18H24N2O2 — CID 7308856
N-[(Z)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2-(4-methoxyphenyl)acetamide (PubChem CID 7308856) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-[(Z)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(Z)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 7308856 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-[(Z)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N/N=C(/C)[C@H]2C[C@H]3CC[C@H]2C3)cc1 |
| InChI | InChI=1S/C18H24N2O2/c1-12(17-10-14-3-6-15(17)9-14)19-20-18(21)11-13-4-7-16(22-2)8-5-13/h4-5,7-8,14-15,17H,3,6,9-11H2,1-2H3,(H,20,21)/b19-12-/t14-,15-,17+/m0/s1 |
| InChIKey | QHCWNDHTNWAHPQ-MPQLPYJRSA-N |
| XLogP | 3.17 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|