C20H34N2O — CID 7261361
N-[(E)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-4-tert-butylcyclohexane-1-carboxamide (PubChem CID 7261361) has the molecular formula C20H34N2O and a molecular weight of 318.51 g/mol. Its IUPAC name is N-[(E)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-4-tert-butylcyclohexane-1-carboxamide.
| Compound Name | N-[(E)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-4-tert-butylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 7261361 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | N-[(E)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethylideneamino]-4-tert-butylcyclohexane-1-carboxamide |
| SMILES | C/C(=N\NC(=O)C1CCC(C(C)(C)C)CC1)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C20H34N2O/c1-13(18-12-14-5-6-16(18)11-14)21-22-19(23)15-7-9-17(10-8-15)20(2,3)4/h14-18H,5-12H2,1-4H3,(H,22,23)/b21-13+/t14-,15?,16-,17?,18-/m0/s1 |
| InChIKey | FJKGFTBWQSAQEC-YOHRNGDVSA-N |
| XLogP | 4.77 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|