C16H22N4O2 — CID 98829133
N,N'-bis[(Z)-[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]oxamide (PubChem CID 98829133) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is N,N'-bis[(Z)-[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]oxamide.
| Compound Name | N,N'-bis[(Z)-[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]oxamide |
|---|---|
| PubChem CID | 98829133 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | N,N'-bis[(Z)-[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]oxamide |
| SMILES | O=C(N/N=C1/C[C@H]2CC[C@H]1C2)C(=O)N/N=C1/C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C16H22N4O2/c21-15(19-17-13-7-9-1-3-11(13)5-9)16(22)20-18-14-8-10-2-4-12(14)6-10/h9-12H,1-8H2,(H,19,21)(H,20,22)/b17-13-,18-14-/t9-,10-,11-,12-/m0/s1 |
| InChIKey | OQLAOXNDCYBUFL-XWDMJMHSSA-N |
| XLogP | 1.57 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|