C13H16N2OS — CID 27451247
N-[(E)-[(1S,4R)-2-bicyclo[2.2.1]heptanylidene]amino]-5-methylthiophene-3-carboxamide (PubChem CID 27451247) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is N-[(E)-[(1S,4R)-2-bicyclo[2.2.1]heptanylidene]amino]-5-methylthiophene-3-carboxamide.
| Compound Name | N-[(E)-[(1S,4R)-2-bicyclo[2.2.1]heptanylidene]amino]-5-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 27451247 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | N-[(E)-[(1S,4R)-2-bicyclo[2.2.1]heptanylidene]amino]-5-methylthiophene-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C2\C[C@@H]3CC[C@H]2C3)cs1 |
| InChI | InChI=1S/C13H16N2OS/c1-8-4-11(7-17-8)13(16)15-14-12-6-9-2-3-10(12)5-9/h4,7,9-10H,2-3,5-6H2,1H3,(H,15,16)/b14-12+/t9-,10+/m1/s1 |
| InChIKey | JOZQPCNFHUMXHF-HSUGPYNZSA-N |
| XLogP | 2.96 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|