C16H20N2O3 — CID 98504378
N-[(Z)-[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]-3,4-dimethoxybenzamide (PubChem CID 98504378) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[(Z)-[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]-3,4-dimethoxybenzamide.
| Compound Name | N-[(Z)-[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 98504378 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-[(Z)-[(1S,4S)-2-bicyclo[2.2.1]heptanylidene]amino]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C2/C[C@H]3CC[C@H]2C3)cc1OC |
| InChI | InChI=1S/C16H20N2O3/c1-20-14-6-5-12(9-15(14)21-2)16(19)18-17-13-8-10-3-4-11(13)7-10/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,18,19)/b17-13-/t10-,11-/m0/s1 |
| InChIKey | VYBBBOSWYNVACK-PDFAESPNSA-N |
| XLogP | 2.61 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|