C16H22N2O3 — CID 9232770
3,4-dimethoxy-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]benzamide (PubChem CID 9232770) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]benzamide.
| Compound Name | 3,4-dimethoxy-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]benzamide |
|---|---|
| PubChem CID | 9232770 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 3,4-dimethoxy-N-[(Z)-[(2S)-2-methylcyclohexylidene]amino]benzamide |
| SMILES | COc1ccc(C(=O)N/N=C2/CCCC[C@@H]2C)cc1OC |
| InChI | InChI=1S/C16H22N2O3/c1-11-6-4-5-7-13(11)17-18-16(19)12-8-9-14(20-2)15(10-12)21-3/h8-11H,4-7H2,1-3H3,(H,18,19)/b17-13-/t11-/m0/s1 |
| InChIKey | JGYHHYMQNQUVTG-DUQXYPDUSA-N |
| XLogP | 3.00 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|